C13H20O6 — CID 11119208
cis-dimethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate (PubChem CID 11119208) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is cis-dimethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11119208 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | cis-dimethyl (3R,4S)-3-acetyl-4-hydroxy-4-methylcyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@](C)(O)[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C13H20O6/c1-8(14)9-7-13(10(15)18-3,11(16)19-4)6-5-12(9,2)17/h9,17H,5-7H2,1-4H3/t9-,12-/m0/s1 |
| InChIKey | ILQFFRIUCNRFMV-CABZTGNLSA-N |
| XLogP | 0.46 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|