C17H26O3 — CID 11119415
(1S,5S)-3,3,11,14,14-pentamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-en-8-one (PubChem CID 11119415) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1S,5S)-3,3,11,14,14-pentamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-en-8-one.
| Compound Name | (1S,5S)-3,3,11,14,14-pentamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-en-8-one |
|---|---|
| PubChem CID | 11119415 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1S,5S)-3,3,11,14,14-pentamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-en-8-one |
| SMILES | CC1=C2CC(=O)CC[C@@H]3OC(C)(C)O[C@@]3(CC1)C2(C)C |
| InChI | InChI=1S/C17H26O3/c1-11-8-9-17-14(19-16(4,5)20-17)7-6-12(18)10-13(11)15(17,2)3/h14H,6-10H2,1-5H3/t14-,17+/m0/s1 |
| InChIKey | LMYKEKORLHPXCH-WMLDXEAASA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|