C15H25NO2Si — CID 11119455
(2E)-2-[(1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetonitrile (PubChem CID 11119455) has the molecular formula C15H25NO2Si and a molecular weight of 279.46 g/mol. Its IUPAC name is (2E)-2-[(1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 11119455 |
| Molecular Formula | C15H25NO2Si |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (2E)-2-[(1R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C/C(=C\C#N)[C@@]2(C)O[C@H]2C1 |
| InChI | InChI=1S/C15H25NO2Si/c1-14(2,3)19(5,6)18-12-9-11(7-8-16)15(4)13(10-12)17-15/h7,12-13H,9-10H2,1-6H3/b11-7+/t12-,13+,15-/m1/s1 |
| InChIKey | LKDXKPRYIRRPTK-JGPBRCEDSA-N |
| XLogP | 3.78 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|