C16H32IN5 — CID 111195875
1-heptan-2-yl-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111195875) has the molecular formula C16H32IN5 and a molecular weight of 421.37 g/mol. Its IUPAC name is 1-heptan-2-yl-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-heptan-2-yl-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111195875 |
| Molecular Formula | C16H32IN5 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-heptan-2-yl-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N\C)NCC(C)Cn1cccn1.I |
| InChI | InChI=1S/C16H31N5.HI/c1-5-6-7-9-15(3)20-16(17-4)18-12-14(2)13-21-11-8-10-19-21;/h8,10-11,14-15H,5-7,9,12-13H2,1-4H3,(H2,17,18,20);1H |
| InChIKey | DCXIWNRTBUXOKQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|