About 3,4-dibutoxythiophene-2,5-dicarbaldehyde
3,4-dibutoxythiophene-2,5-dicarbaldehyde (PubChem CID 11119625) has the molecular formula C14H20O4S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 3,4-dibutoxythiophene-2,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 3,4-dibutoxythiophene-2,5-dicarbaldehyde |
| PubChem CID | 11119625 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3,4-dibutoxythiophene-2,5-dicarbaldehyde |
| SMILES | CCCCOc1c(C=O)sc(C=O)c1OCCCC |
| InChI | InChI=1S/C14H20O4S/c1-3-5-7-17-13-11(9-15)19-12(10-16)14(13)18-8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | CLRZYGVCYABNSM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibutoxythiophene-2,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutoxythiophene-2,5-dicarbaldehyde?
The IUPAC name of 3,4-dibutoxythiophene-2,5-dicarbaldehyde (CID 11119625) is 3,4-dibutoxythiophene-2,5-dicarbaldehyde.
What is the SMILES notation for 3,4-dibutoxythiophene-2,5-dicarbaldehyde?
The canonical SMILES for 3,4-dibutoxythiophene-2,5-dicarbaldehyde is CCCCOc1c(C=O)sc(C=O)c1OCCCC.
What is the InChIKey of 3,4-dibutoxythiophene-2,5-dicarbaldehyde?
The InChIKey is CLRZYGVCYABNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4S/c1-3-5-7-17-13-11(9-15)19-12(10-16)14(13)18-8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 3,4-dibutoxythiophene-2,5-dicarbaldehyde?
3,4-dibutoxythiophene-2,5-dicarbaldehyde has a molecular weight of 284.38 g/mol, XLogP of 3.73, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutoxythiophene-2,5-dicarbaldehyde is sourced from PubChem (CID 11119625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).