C18H21Cl2N5O — CID 111198078
3-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 111198078) has the molecular formula C18H21Cl2N5O and a molecular weight of 394.31 g/mol. Its IUPAC name is 3-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111198078 |
| Molecular Formula | C18H21Cl2N5O |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1cccc(C)n1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N5O/c1-12-4-3-5-16(24-12)25-17(26)8-9-22-18(21-2)23-11-13-6-7-14(19)10-15(13)20/h3-7,10H,8-9,11H2,1-2H3,(H2,21,22,23)(H,24,25,26) |
| InChIKey | RDIQYMOKIXTPCO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|