C20H21N5S — CID 1111986
12,12,14,14-tetramethyl-4-phenyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 1111986) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is 12,12,14,14-tetramethyl-4-phenyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 12,12,14,14-tetramethyl-4-phenyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 1111986 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 12,12,14,14-tetramethyl-4-phenyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC1(C)Cc2c(sc3ncn4nc(-c5ccccc5)nc4c23)C(C)(C)N1 |
| InChI | InChI=1S/C20H21N5S/c1-19(2)10-13-14-17-22-16(12-8-6-5-7-9-12)23-25(17)11-21-18(14)26-15(13)20(3,4)24-19/h5-9,11,24H,10H2,1-4H3 |
| InChIKey | PBSMXBGTYBTJBO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |