C19H15N5OS2 — CID 1111993
2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-ylmethylsulfanyl)-1,3-benzoxazole (PubChem CID 1111993) has the molecular formula C19H15N5OS2 and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-ylmethylsulfanyl)-1,3-benzoxazole.
| Compound Name | 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-ylmethylsulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 1111993 |
| Molecular Formula | C19H15N5OS2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-ylmethylsulfanyl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(SCc3nc4c5c6c(sc5ncn4n3)CCCC6)nc2c1 |
| InChI | InChI=1S/C19H15N5OS2/c1-4-8-14-11(5-1)16-17-22-15(23-24(17)10-20-18(16)27-14)9-26-19-21-12-6-2-3-7-13(12)25-19/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | HVRFWLZCCRFAFS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |