C18H33IN4 — CID 111199961
1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111199961) has the molecular formula C18H33IN4 and a molecular weight of 432.39 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111199961 |
| Molecular Formula | C18H33IN4 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCC(C)N(C)CCN/C(=N\C)NCCCc1ccccc1.I |
| InChI | InChI=1S/C18H32N4.HI/c1-5-16(2)22(4)15-14-21-18(19-3)20-13-9-12-17-10-7-6-8-11-17;/h6-8,10-11,16H,5,9,12-15H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | MDNPYUBDYOSYNH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|