About 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol
1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol (PubChem CID 11120097) has the molecular formula C16H20F3NO
and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol |
| PubChem CID | 11120097 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol |
| SMILES | Cc1cccc(C)c1/N=C(\C(F)(F)F)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H20F3NO/c1-11-7-6-8-12(2)13(11)20-14(16(17,18)19)15(21)9-4-3-5-10-15/h6-8,21H,3-5,9-10H2,1-2H3/b20-14- |
| InChIKey | NLQVOGQYOHUPAE-ZHZULCJRSA-N |
| XLogP | 4.63 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol?
The IUPAC name of 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol (CID 11120097) is 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol?
The canonical SMILES for 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol is Cc1cccc(C)c1/N=C(\C(F)(F)F)C1(O)CCCCC1.
What is the InChIKey of 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol?
The InChIKey is NLQVOGQYOHUPAE-ZHZULCJRSA-N. The full InChI is InChI=1S/C16H20F3NO/c1-11-7-6-8-12(2)13(11)20-14(16(17,18)19)15(21)9-4-3-5-10-15/h6-8,21H,3-5,9-10H2,1-2H3/b20-14-.
What are the key properties of 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol?
1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol has a molecular weight of 299.34 g/mol, XLogP of 4.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N-(2,6-dimethylphenyl)-C-(trifluoromethyl)carbonimidoyl]cyclohexan-1-ol is sourced from PubChem (CID 11120097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).