C20H34IN3O4 — CID 111201051
methyl 7-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111201051) has the molecular formula C20H34IN3O4 and a molecular weight of 507.41 g/mol. Its IUPAC name is methyl 7-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111201051 |
| Molecular Formula | C20H34IN3O4 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | methyl 7-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCCCCCCC(=O)OC.I |
| InChI | InChI=1S/C20H33N3O4.HI/c1-5-21-20(22-13-9-7-6-8-10-19(24)27-4)23-15-16-11-12-17(25-2)18(14-16)26-3;/h11-12,14H,5-10,13,15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | WJGXAXGUWYYVEB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|