C23H33IN4O2 — CID 111201189
1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111201189) has the molecular formula C23H33IN4O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111201189 |
| Molecular Formula | C23H33IN4O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCc2ccccc2C1)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C23H32N4O2.HI/c1-24-23(26-16-18-9-10-21(28-2)22(15-18)29-3)25-12-6-13-27-14-11-19-7-4-5-8-20(19)17-27;/h4-5,7-10,15H,6,11-14,16-17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | JENIPLYYHQNRIK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|