About [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol
[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol (PubChem CID 11120125) has the molecular formula C15H20N6O
and a molecular weight of 300.37 g/mol. Its IUPAC name is [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol |
| PubChem CID | 11120125 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccnc(CO)n3)CC2)n1 |
| InChI | InChI=1S/C15H20N6O/c1-11-9-12(2)18-15(17-11)21-7-5-20(6-8-21)14-3-4-16-13(10-22)19-14/h3-4,9,22H,5-8,10H2,1-2H3 |
| InChIKey | KXEHNZFYMZBSFZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol?
The IUPAC name of [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol (CID 11120125) is [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol.
What is the SMILES notation for [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol?
The canonical SMILES for [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol is Cc1cc(C)nc(N2CCN(c3ccnc(CO)n3)CC2)n1.
What is the InChIKey of [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol?
The InChIKey is KXEHNZFYMZBSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O/c1-11-9-12(2)18-15(17-11)21-7-5-20(6-8-21)14-3-4-16-13(10-22)19-14/h3-4,9,22H,5-8,10H2,1-2H3.
What are the key properties of [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol?
[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol has a molecular weight of 300.37 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]pyrimidin-2-yl]methanol is sourced from PubChem (CID 11120125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).