C16H32O3Si — CID 11120141
3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,6-trimethylcyclohexane-1-carbaldehyde (PubChem CID 11120141) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,6-trimethylcyclohexane-1-carbaldehyde.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,6-trimethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 11120141 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,6-trimethylcyclohexane-1-carbaldehyde |
| SMILES | CC1(O)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1C=O |
| InChI | InChI=1S/C16H32O3Si/c1-14(2,3)20(7,8)19-13-9-10-16(6,18)12(11-17)15(13,4)5/h11-13,18H,9-10H2,1-8H3 |
| InChIKey | BCWKJELNEYZMQR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|