C22H33IN4O2 — CID 111201421
1-[(3,4-dimethoxyphenyl)methyl]-3-[3-[4-(dimethylamino)phenyl]propyl]-2-methylguanidine;hydroiodide (PubChem CID 111201421) has the molecular formula C22H33IN4O2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-[4-(dimethylamino)phenyl]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-[4-(dimethylamino)phenyl]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111201421 |
| Molecular Formula | C22H33IN4O2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[3-[4-(dimethylamino)phenyl]propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccc(N(C)C)cc1)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H32N4O2.HI/c1-23-22(25-16-18-10-13-20(27-4)21(15-18)28-5)24-14-6-7-17-8-11-19(12-9-17)26(2)3;/h8-13,15H,6-7,14,16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | XFCFRMIEMCEDFL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|