C20H33NO — CID 11120228
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidin-2-one (PubChem CID 11120228) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidin-2-one.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidin-2-one |
|---|---|
| PubChem CID | 11120228 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCCCC1=O |
| InChI | InChI=1S/C20H33NO/c1-17(2)9-7-10-18(3)11-8-12-19(4)14-16-21-15-6-5-13-20(21)22/h9,11,14H,5-8,10,12-13,15-16H2,1-4H3/b18-11+,19-14+ |
| InChIKey | NIYHCJHBUMZSLH-MMOYSQFZSA-N |
| XLogP | 5.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|