C21H35IN4O2S — CID 111202407
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111202407) has the molecular formula C21H35IN4O2S and a molecular weight of 534.51 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111202407 |
| Molecular Formula | C21H35IN4O2S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC)c1)NCC1(N2CCSCC2)CCCC1.I |
| InChI | InChI=1S/C21H34N4O2S.HI/c1-22-20(23-15-17-6-7-18(26-2)19(14-17)27-3)24-16-21(8-4-5-9-21)25-10-12-28-13-11-25;/h6-7,14H,4-5,8-13,15-16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | HFKCEHYWIIJNOJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|