C18H33N5 — CID 111203378
2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111203378) has the molecular formula C18H33N5 and a molecular weight of 319.50 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111203378 |
| Molecular Formula | C18H33N5 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 2-[[2-(dimethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N(C)C)NC(C)CCC(C)C |
| InChI | InChI=1S/C18H33N5/c1-7-19-18(22-15(4)11-10-14(2)3)21-13-16-9-8-12-20-17(16)23(5)6/h8-9,12,14-15H,7,10-11,13H2,1-6H3,(H2,19,21,22) |
| InChIKey | CMKCABPNZUVPPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|