C15H32F3IN4 — CID 111204053
2-methyl-1-(5-methylhexan-2-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111204053) has the molecular formula C15H32F3IN4 and a molecular weight of 452.35 g/mol. Its IUPAC name is 2-methyl-1-(5-methylhexan-2-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(5-methylhexan-2-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111204053 |
| Molecular Formula | C15H32F3IN4 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-methyl-1-(5-methylhexan-2-yl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN(C)CC(F)(F)F)NC(C)CCC(C)C.I |
| InChI | InChI=1S/C15H31F3N4.HI/c1-12(2)7-8-13(3)21-14(19-4)20-9-6-10-22(5)11-15(16,17)18;/h12-13H,6-11H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | HXLKZWTXSCTGTQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|