C17H33IN4S — CID 111204479
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide (PubChem CID 111204479) has the molecular formula C17H33IN4S and a molecular weight of 452.45 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111204479 |
| Molecular Formula | C17H33IN4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N/C)NC(C)CCC(C)C)sc1C.I |
| InChI | InChI=1S/C17H32N4S.HI/c1-7-15-14(5)22-16(21-15)10-11-19-17(18-6)20-13(4)9-8-12(2)3;/h12-13H,7-11H2,1-6H3,(H2,18,19,20);1H |
| InChIKey | HUWMEPOZRVAPQE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|