C16H22O6 — CID 11120457
(1S,2R,4R,5R)-4-[(R)-ethoxy-[(1R,2R,5S)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl]-2-methyl-3,6-dioxabicyclo[3.2.1]octan-7-one (PubChem CID 11120457) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1S,2R,4R,5R)-4-[(R)-ethoxy-[(1R,2R,5S)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl]-2-methyl-3,6-dioxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,2R,4R,5R)-4-[(R)-ethoxy-[(1R,2R,5S)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl]-2-methyl-3,6-dioxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 11120457 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1S,2R,4R,5R)-4-[(R)-ethoxy-[(1R,2R,5S)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl]-2-methyl-3,6-dioxabicyclo[3.2.1]octan-7-one |
| SMILES | CCO[C@H]([C@@H]1OC(=O)[C@H]2CC[C@@H]12)[C@@H]1O[C@H](C)[C@@H]2C[C@H]1OC2=O |
| InChI | InChI=1S/C16H22O6/c1-3-19-14(12-8-4-5-9(8)15(17)22-12)13-11-6-10(7(2)20-13)16(18)21-11/h7-14H,3-6H2,1-2H3/t7-,8-,9+,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | LHXXIKVMMASDTI-AZLQIUJGSA-N |
| XLogP | 1.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |