C18H36N4O — CID 111204664
N-cyclopropyl-4-[[N'-methyl-N-(7-methyloctyl)carbamimidoyl]amino]butanamide (PubChem CID 111204664) has the molecular formula C18H36N4O and a molecular weight of 324.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N'-methyl-N-(7-methyloctyl)carbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N'-methyl-N-(7-methyloctyl)carbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111204664 |
| Molecular Formula | C18H36N4O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | N-cyclopropyl-4-[[N'-methyl-N-(7-methyloctyl)carbamimidoyl]amino]butanamide |
| SMILES | C/N=C(\NCCCCCCC(C)C)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C18H36N4O/c1-15(2)9-6-4-5-7-13-20-18(19-3)21-14-8-10-17(23)22-16-11-12-16/h15-16H,4-14H2,1-3H3,(H,22,23)(H2,19,20,21) |
| InChIKey | KTMUJHSZPQFPAL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|