C19H25N7O — CID 111205342
N-[2-[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]ethyl]benzamide (PubChem CID 111205342) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[2-[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111205342 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[2-[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H25N7O/c1-20-18(24-11-10-21-17(27)16-6-3-2-4-7-16)25-12-14-26(15-13-25)19-22-8-5-9-23-19/h2-9H,10-15H2,1H3,(H,20,24)(H,21,27) |
| InChIKey | RGJKIWTUGGZBQF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|