C23H32N8O — CID 111206908
N-ethyl-N'-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111206908) has the molecular formula C23H32N8O and a molecular weight of 436.56 g/mol. Its IUPAC name is N-ethyl-N'-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111206908 |
| Molecular Formula | C23H32N8O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-ethyl-N'-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCN(c2ccccc2)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H32N8O/c1-2-24-22(30-15-17-31(18-16-30)23-25-9-6-10-26-23)27-19-21(32)29-13-11-28(12-14-29)20-7-4-3-5-8-20/h3-10H,2,11-19H2,1H3,(H,24,27) |
| InChIKey | RDBOBYOXKZMRLS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|