C21H29N7O — CID 111207226
N-[4-[[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 111207226) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[4-[[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111207226 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[4-[[[N-methyl-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(CN/C(=N\C)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C21H29N7O/c1-3-5-19(29)26-18-8-6-17(7-9-18)16-25-20(22-2)27-12-14-28(15-13-27)21-23-10-4-11-24-21/h4,6-11H,3,5,12-16H2,1-2H3,(H,22,25)(H,26,29) |
| InChIKey | XCEMTAJMYXSHTD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|