About 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one
3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one (PubChem CID 11120872) has the molecular formula C16H10ClN5O
and a molecular weight of 323.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one |
| PubChem CID | 11120872 |
| Molecular Formula | C16H10ClN5O |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-n2cncn2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10ClN5O/c17-11-5-7-12(8-6-11)22-15(23)13-3-1-2-4-14(13)20-16(22)21-10-18-9-19-21/h1-10H |
| InChIKey | XWHPXLAOZUVLEB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one (CID 11120872) is 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one is O=c1c2ccccc2nc(-n2cncn2)n1-c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one?
The InChIKey is XWHPXLAOZUVLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN5O/c17-11-5-7-12(8-6-11)22-15(23)13-3-1-2-4-14(13)20-16(22)21-10-18-9-19-21/h1-10H.
What are the key properties of 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one?
3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one has a molecular weight of 323.74 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one is sourced from PubChem (CID 11120872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).