C17H30F3IN4 — CID 111208770
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111208770) has the molecular formula C17H30F3IN4 and a molecular weight of 474.35 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111208770 |
| Molecular Formula | C17H30F3IN4 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC1=CCCCC1)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C17H29F3N4.HI/c1-21-16(22-9-7-14-5-3-2-4-6-14)23-11-15-8-10-24(12-15)13-17(18,19)20;/h5,15H,2-4,6-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | VCGBKBGEASHEAA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|