C18H33N3O2 — CID 111209320
1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethylguanidine (PubChem CID 111209320) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethylguanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111209320 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)COCC1CC1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H33N3O2/c1-2-19-18(20-11-10-15-6-4-3-5-7-15)21-12-17(22)14-23-13-16-8-9-16/h6,16-17,22H,2-5,7-14H2,1H3,(H2,19,20,21) |
| InChIKey | VEPHOOAOSWAKGJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|