C23H35FN4O — CID 111209374
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111209374) has the molecular formula C23H35FN4O and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111209374 |
| Molecular Formula | C23H35FN4O |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H35FN4O/c1-2-25-23(26-13-10-18-6-4-3-5-7-18)27-17-19-8-9-22(21(24)16-19)28-14-11-20(29)12-15-28/h6,8-9,16,20,29H,2-5,7,10-15,17H2,1H3,(H2,25,26,27) |
| InChIKey | NWMSKUIBSPIBIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|