C16H10F4OS — CID 11120943
(16R)-16-fluoro-16-(trifluoromethyl)-15lambda4-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene 15-oxide (PubChem CID 11120943) has the molecular formula C16H10F4OS and a molecular weight of 326.31 g/mol. Its IUPAC name is (16R)-16-fluoro-16-(trifluoromethyl)-15lambda4-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene 15-oxide.
| Compound Name | (16R)-16-fluoro-16-(trifluoromethyl)-15lambda4-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene 15-oxide |
|---|---|
| PubChem CID | 11120943 |
| Molecular Formula | C16H10F4OS |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (16R)-16-fluoro-16-(trifluoromethyl)-15lambda4-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene 15-oxide |
| SMILES | O=S1C2c3ccccc3C(c3ccccc32)[C@]1(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F4OS/c17-15(16(18,19)20)13-9-5-1-3-7-11(9)14(22(15)21)12-8-4-2-6-10(12)13/h1-8,13-14H/t13?,14?,15-,22?/m1/s1 |
| InChIKey | PTGYKOGKYFAEOZ-LXAGUMONSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |