C16H28O5Si — CID 11121013
(3aR,4R,5S,7aS)-7a-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one (PubChem CID 11121013) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-7a-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3aR,4R,5S,7aS)-7a-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11121013 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3aR,4R,5S,7aS)-7a-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12C=C[C@H](O)[C@@](C)(CO)[C@@H]1COC2=O |
| InChI | InChI=1S/C16H28O5Si/c1-14(2,3)22(5,6)21-16-8-7-12(18)15(4,10-17)11(16)9-20-13(16)19/h7-8,11-12,17-18H,9-10H2,1-6H3/t11-,12-,15-,16-/m0/s1 |
| InChIKey | ZVLSECDRDPLWRA-APYUEPQZSA-N |
| XLogP | 1.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|