C18H31ClO3 — CID 11121095
(2S,3R,4S)-4-(6-chlorohexyl)-2-(4-hydroxy-2-oxobutyl)-3-propan-2-ylcyclopentan-1-one (PubChem CID 11121095) has the molecular formula C18H31ClO3 and a molecular weight of 330.90 g/mol. Its IUPAC name is (2S,3R,4S)-4-(6-chlorohexyl)-2-(4-hydroxy-2-oxobutyl)-3-propan-2-ylcyclopentan-1-one.
| Compound Name | (2S,3R,4S)-4-(6-chlorohexyl)-2-(4-hydroxy-2-oxobutyl)-3-propan-2-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 11121095 |
| Molecular Formula | C18H31ClO3 |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (2S,3R,4S)-4-(6-chlorohexyl)-2-(4-hydroxy-2-oxobutyl)-3-propan-2-ylcyclopentan-1-one |
| SMILES | CC(C)[C@@H]1[C@@H](CCCCCCCl)CC(=O)[C@H]1CC(=O)CCO |
| InChI | InChI=1S/C18H31ClO3/c1-13(2)18-14(7-5-3-4-6-9-19)11-17(22)16(18)12-15(21)8-10-20/h13-14,16,18,20H,3-12H2,1-2H3/t14-,16+,18+/m0/s1 |
| InChIKey | GVKJOQDXEYPULC-YXJHDRRASA-N |
| XLogP | 3.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|