C19H27NO2S — CID 11121170
(2S,3S)-2-[(S)-cyclohexylsulfinyl]-N,N-dimethyl-3-phenylpent-4-enamide (PubChem CID 11121170) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is (2S,3S)-2-[(S)-cyclohexylsulfinyl]-N,N-dimethyl-3-phenylpent-4-enamide.
| Compound Name | (2S,3S)-2-[(S)-cyclohexylsulfinyl]-N,N-dimethyl-3-phenylpent-4-enamide |
|---|---|
| PubChem CID | 11121170 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (2S,3S)-2-[(S)-cyclohexylsulfinyl]-N,N-dimethyl-3-phenylpent-4-enamide |
| SMILES | C=C[C@@H](c1ccccc1)[C@@H](C(=O)N(C)C)[S@@](=O)C1CCCCC1 |
| InChI | InChI=1S/C19H27NO2S/c1-4-17(15-11-7-5-8-12-15)18(19(21)20(2)3)23(22)16-13-9-6-10-14-16/h4-5,7-8,11-12,16-18H,1,6,9-10,13-14H2,2-3H3/t17-,18-,23-/m0/s1 |
| InChIKey | QGNWOGGXULMWRE-BSRJHKFKSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|