C21H24FN3 — CID 11121274
N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylbutane-1,4-diamine (PubChem CID 11121274) has the molecular formula C21H24FN3 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 11121274 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNc1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H24FN3/c1-25(2)14-6-5-13-23-21-15-20(16-9-11-17(22)12-10-16)24-19-8-4-3-7-18(19)21/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,23,24) |
| InChIKey | RWJQGOUHQORFPE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|