C18H33IN4O3 — CID 111213132
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111213132) has the molecular formula C18H33IN4O3 and a molecular weight of 480.39 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111213132 |
| Molecular Formula | C18H33IN4O3 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCCN(C)CCOC.I |
| InChI | InChI=1S/C18H32N4O3.HI/c1-19-18(21-10-11-22(2)12-13-23-3)20-9-8-15-6-7-16(24-4)17(14-15)25-5;/h6-7,14H,8-13H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | YVAPMJCSCAUWDV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|