C24H36N4O2 — CID 111213375
1-[[3-(diethylaminomethyl)phenyl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111213375) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[[3-(diethylaminomethyl)phenyl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[3-(diethylaminomethyl)phenyl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111213375 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-[[3-(diethylaminomethyl)phenyl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | CCN(CC)Cc1cccc(CN/C(=N\C)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C24H36N4O2/c1-6-28(7-2)18-21-10-8-9-20(15-21)17-27-24(25-3)26-14-13-19-11-12-22(29-4)23(16-19)30-5/h8-12,15-16H,6-7,13-14,17-18H2,1-5H3,(H2,25,26,27) |
| InChIKey | GCXNFLWLESOXIM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|