C19H31IN4O3 — CID 111213558
N-cyclopropyl-4-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111213558) has the molecular formula C19H31IN4O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111213558 |
| Molecular Formula | C19H31IN4O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-cyclopropyl-4-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H30N4O3.HI/c1-20-19(21-11-4-5-18(24)23-15-7-8-15)22-12-10-14-6-9-16(25-2)17(13-14)26-3;/h6,9,13,15H,4-5,7-8,10-12H2,1-3H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | VDUQGCWYCXJIOR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|