C21H28O4 — CID 11121491
(6R,8S,9S,10S,13S,14S,17R)-13-ethyl-17-ethynyl-6,10,17-trihydroxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 11121491) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (6R,8S,9S,10S,13S,14S,17R)-13-ethyl-17-ethynyl-6,10,17-trihydroxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6R,8S,9S,10S,13S,14S,17R)-13-ethyl-17-ethynyl-6,10,17-trihydroxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11121491 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (6R,8S,9S,10S,13S,14S,17R)-13-ethyl-17-ethynyl-6,10,17-trihydroxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3C[C@@H](O)C4=CC(=O)CC[C@]4(O)[C@H]3CC[C@@]21CC |
| InChI | InChI=1S/C21H28O4/c1-3-19-8-6-16-14(15(19)7-9-20(19,24)4-2)12-18(23)17-11-13(22)5-10-21(16,17)25/h2,11,14-16,18,23-25H,3,5-10,12H2,1H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | OGVFNLLFWYKXHA-VWUMJDOOSA-N |
| XLogP | 1.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|