About Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate
Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate (PubChem CID 11121565) has the molecular formula C19H24OSe
and a molecular weight of 347.36 g/mol. Its IUPAC name is Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate.
Molecular Properties
| Compound Name | Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate |
| PubChem CID | 11121565 |
| Molecular Formula | C19H24OSe |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate |
| SMILES | CC(C)=C[C@@H]1[C@@H](/C(C)=C/C(=O)[Se]c2ccccc2)C1(C)C |
| InChI | InChI=1S/C19H24OSe/c1-13(2)11-16-18(19(16,4)5)14(3)12-17(20)21-15-9-7-6-8-10-15/h6-12,16,18H,1-5H3/b14-12+/t16-,18-/m1/s1 |
| InChIKey | OWCAOXYDGDDXSS-UZICZHQRSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate?
The IUPAC name of Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate (CID 11121565) is Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate.
What is the SMILES notation for Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate?
The canonical SMILES for Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate is CC(C)=C[C@@H]1[C@@H](/C(C)=C/C(=O)[Se]c2ccccc2)C1(C)C.
What is the InChIKey of Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate?
The InChIKey is OWCAOXYDGDDXSS-UZICZHQRSA-N. The full InChI is InChI=1S/C19H24OSe/c1-13(2)11-16-18(19(16,4)5)14(3)12-17(20)21-15-9-7-6-8-10-15/h6-12,16,18H,1-5H3/b14-12+/t16-,18-/m1/s1.
What are the key properties of Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate?
Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate has a molecular weight of 347.36 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Se-phenyl (E)-3-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]but-2-eneselenoate is sourced from PubChem (CID 11121565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).