C22H22O4 — CID 11121660
ethyl (3aS,6aR)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate (PubChem CID 11121660) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl (3aS,6aR)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate.
| Compound Name | ethyl (3aS,6aR)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate |
|---|---|
| PubChem CID | 11121660 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl (3aS,6aR)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-6a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@@H]1C(c1ccccc1)(c1ccccc1)OC2=O |
| InChI | InChI=1S/C22H22O4/c1-2-25-19(23)21-15-9-14-18(21)22(26-20(21)24,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,2,9,14-15H2,1H3/t18-,21+/m0/s1 |
| InChIKey | FDDVPXMFRFJXAU-GHTZIAJQSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|