C22H38O3 — CID 11121673
[(1R,3S,4R,7R,8R,10S,11S,12S)-10-hydroxy-1,4-dimethyl-12-propan-2-yl-8-tricyclo[9.3.0.03,7]tetradecanyl]methyl acetate (PubChem CID 11121673) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is [(1R,3S,4R,7R,8R,10S,11S,12S)-10-hydroxy-1,4-dimethyl-12-propan-2-yl-8-tricyclo[9.3.0.03,7]tetradecanyl]methyl acetate.
| Compound Name | [(1R,3S,4R,7R,8R,10S,11S,12S)-10-hydroxy-1,4-dimethyl-12-propan-2-yl-8-tricyclo[9.3.0.03,7]tetradecanyl]methyl acetate |
|---|---|
| PubChem CID | 11121673 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | [(1R,3S,4R,7R,8R,10S,11S,12S)-10-hydroxy-1,4-dimethyl-12-propan-2-yl-8-tricyclo[9.3.0.03,7]tetradecanyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](O)[C@H]2[C@H](C(C)C)CC[C@]2(C)C[C@@H]2[C@H]1CC[C@H]2C |
| InChI | InChI=1S/C22H38O3/c1-13(2)17-8-9-22(5)11-19-14(3)6-7-18(19)16(12-25-15(4)23)10-20(24)21(17)22/h13-14,16-21,24H,6-12H2,1-5H3/t14-,16+,17+,18+,19+,20+,21-,22-/m1/s1 |
| InChIKey | MJUQGWKYUXFFTO-YXNKXFRKSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |