C19H28N6S — CID 111219451
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219451) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219451 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1csc(C(C)(C)C)n1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H28N6S/c1-19(2,3)17-23-15(14-26-17)13-22-18(20-4)25-11-9-24(10-12-25)16-7-5-6-8-21-16/h5-8,14H,9-13H2,1-4H3,(H,20,22) |
| InChIKey | XKRLGFBQYVYWKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|