About 6-octoxy-3,4-diphenylpyridazine
6-octoxy-3,4-diphenylpyridazine (PubChem CID 11121964) has the molecular formula C24H28N2O
and a molecular weight of 360.50 g/mol. Its IUPAC name is 6-octoxy-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 6-octoxy-3,4-diphenylpyridazine |
| PubChem CID | 11121964 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 6-octoxy-3,4-diphenylpyridazine |
| SMILES | CCCCCCCCOc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H28N2O/c1-2-3-4-5-6-13-18-27-23-19-22(20-14-9-7-10-15-20)24(26-25-23)21-16-11-8-12-17-21/h7-12,14-17,19H,2-6,13,18H2,1H3 |
| InChIKey | MRVWSOCNTVSLLP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-octoxy-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-octoxy-3,4-diphenylpyridazine?
The IUPAC name of 6-octoxy-3,4-diphenylpyridazine (CID 11121964) is 6-octoxy-3,4-diphenylpyridazine.
What is the SMILES notation for 6-octoxy-3,4-diphenylpyridazine?
The canonical SMILES for 6-octoxy-3,4-diphenylpyridazine is CCCCCCCCOc1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of 6-octoxy-3,4-diphenylpyridazine?
The InChIKey is MRVWSOCNTVSLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O/c1-2-3-4-5-6-13-18-27-23-19-22(20-14-9-7-10-15-20)24(26-25-23)21-16-11-8-12-17-21/h7-12,14-17,19H,2-6,13,18H2,1H3.
What are the key properties of 6-octoxy-3,4-diphenylpyridazine?
6-octoxy-3,4-diphenylpyridazine has a molecular weight of 360.50 g/mol, XLogP of 6.55, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-octoxy-3,4-diphenylpyridazine is sourced from PubChem (CID 11121964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).