C22H30N6 — CID 111220429
N-[2-(2,3-dihydroindol-1-yl)propyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111220429) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)propyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)propyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220429 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)propyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC(C)N1CCc2ccccc21)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H30N6/c1-18(28-12-10-19-7-3-4-8-20(19)28)17-25-22(23-2)27-15-13-26(14-16-27)21-9-5-6-11-24-21/h3-9,11,18H,10,12-17H2,1-2H3,(H,23,25) |
| InChIKey | ZBQPLQKEEUYZCD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|