C22H40O2Si — CID 11122072
tert-butyl-dimethyl-[[(1R,3S,5S,6S,9S,10R)-6-methyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]silane (PubChem CID 11122072) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,3S,5S,6S,9S,10R)-6-methyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,3S,5S,6S,9S,10R)-6-methyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]silane |
|---|---|
| PubChem CID | 11122072 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,3S,5S,6S,9S,10R)-6-methyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]silane |
| SMILES | C[C@H]1CC2=C[C@H]3C[C@@H](C[C@@H]1O[Si](C)(C)C(C)(C)C)[C@@H]2[C@@H]3OC(C)(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-14-10-15-11-17-12-16(19(15)20(17)23-21(2,3)4)13-18(14)24-25(8,9)22(5,6)7/h11,14,16-20H,10,12-13H2,1-9H3/t14-,16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | DWJUNSPRLSNZMZ-JUAFXFSUSA-N |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|