C10H15F8O3P — CID 11122104
6-diethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluorohexane (PubChem CID 11122104) has the molecular formula C10H15F8O3P and a molecular weight of 366.19 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluorohexane.
| Compound Name | 6-diethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluorohexane |
|---|---|
| PubChem CID | 11122104 |
| Molecular Formula | C10H15F8O3P |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 6-diethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluorohexane |
| SMILES | CCOP(=O)(CCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCC |
| InChI | InChI=1S/C10H15F8O3P/c1-3-20-22(19,21-4-2)6-5-8(13,14)10(17,18)9(15,16)7(11)12/h7H,3-6H2,1-2H3 |
| InChIKey | KPALENHSLZIKAX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|