C21H38O3Si — CID 11122127
2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetic acid (PubChem CID 11122127) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 11122127 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CC=C[C@@H]1CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-7-8-9-13-19(24-25(5,6)21(2,3)4)15-14-17-11-10-12-18(17)16-20(22)23/h10,12,14-15,17-19H,7-9,11,13,16H2,1-6H3,(H,22,23)/b15-14+/t17-,18-,19+/m1/s1 |
| InChIKey | XZAXROZFGDAHEP-ATQSKCOQSA-N |
| XLogP | 6.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|