C18H21BrFN5 — CID 111221387
N-[(2-bromo-5-fluorophenyl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111221387) has the molecular formula C18H21BrFN5 and a molecular weight of 406.30 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111221387 |
| Molecular Formula | C18H21BrFN5 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-N'-methyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cc(F)ccc1Br)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H21BrFN5/c1-21-18(23-13-14-12-15(20)5-6-16(14)19)25-10-8-24(9-11-25)17-4-2-3-7-22-17/h2-7,12H,8-11,13H2,1H3,(H,21,23) |
| InChIKey | DQZQEFBHGQZIDO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|