C20H26N6O — CID 111221389
N-[3-[[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]acetamide (PubChem CID 111221389) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[3-[[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111221389 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[3-[[[N-methyl-C-(4-pyridin-2-ylpiperazin-1-yl)carbonimidoyl]amino]methyl]phenyl]acetamide |
| SMILES | C/N=C(\NCc1cccc(NC(C)=O)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N6O/c1-16(27)24-18-7-5-6-17(14-18)15-23-20(21-2)26-12-10-25(11-13-26)19-8-3-4-9-22-19/h3-9,14H,10-13,15H2,1-2H3,(H,21,23)(H,24,27) |
| InChIKey | JNZANZUANUXHLS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|