About [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate
[(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate (PubChem CID 11122156) has the molecular formula C21H25NO3Si
and a molecular weight of 367.52 g/mol. Its IUPAC name is [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate.
Molecular Properties
| Compound Name | [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate |
| PubChem CID | 11122156 |
| Molecular Formula | C21H25NO3Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate |
| SMILES | Cc1cccc2c1N(C(OC(=O)C[Si](C)(C)C)c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C21H25NO3Si/c1-15-9-8-12-17-13-18(23)22(20(15)17)21(16-10-6-5-7-11-16)25-19(24)14-26(2,3)4/h5-12,21H,13-14H2,1-4H3 |
| InChIKey | YKPIMPKWBLIIKA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate?
The IUPAC name of [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate (CID 11122156) is [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate.
What is the SMILES notation for [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate?
The canonical SMILES for [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate is Cc1cccc2c1N(C(OC(=O)C[Si](C)(C)C)c1ccccc1)C(=O)C2.
What is the InChIKey of [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate?
The InChIKey is YKPIMPKWBLIIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3Si/c1-15-9-8-12-17-13-18(23)22(20(15)17)21(16-10-6-5-7-11-16)25-19(24)14-26(2,3)4/h5-12,21H,13-14H2,1-4H3.
What are the key properties of [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate?
[(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate has a molecular weight of 367.52 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-methyl-2-oxo-3H-indol-1-yl)-phenylmethyl] 2-trimethylsilylacetate is sourced from PubChem (CID 11122156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).